ChemNet > CAS > 118337-33-0 2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one
118337-33-0 2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one
| Название продукта |
2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one |
| Синонимы |
2-bromo-1-(3-methyl-1-benzothiophen-2-yl)ethanone; 2-bromo-1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethanone |
| Молекулярная формула |
C11H8BrClOS |
| Молекулярный вес |
303.6026 |
| InChI |
InChI=1/C11H8BrClOS/c1-6-8-4-7(13)2-3-10(8)15-11(6)9(14)5-12/h2-4H,5H2,1H3 |
| Регистрационный номер CAS |
118337-33-0 |
| Молекулярная структура |
![118337-33-0 2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one](https://images-a.chemnet.com/suppliers/chembase/348/34859.gif)
|
| Плотность |
1.632g/cm3 |
| Температура плавления |
94℃ |
| Точка кипения |
396.2°C at 760 mmHg |
| Показатель преломления |
1.676 |
| Температура вспышки |
193.4°C |
| Символы опасности |
 C:Corrosive;
|
| Риск коды |
R34:Causes burns.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
